C16H16ClFN2O3 — CID 139640784
7-chloro-6-fluoro-4-oxo-1-(2,2,3,3-tetramethylaziridin-1-yl)quinoline-3-carboxylic acid (PubChem CID 139640784) has the molecular formula C16H16ClFN2O3 and a molecular weight of 338.77 g/mol. Its IUPAC name is 7-chloro-6-fluoro-4-oxo-1-(2,2,3,3-tetramethylaziridin-1-yl)quinoline-3-carboxylic acid.
| Compound Name | 7-chloro-6-fluoro-4-oxo-1-(2,2,3,3-tetramethylaziridin-1-yl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139640784 |
| Molecular Formula | C16H16ClFN2O3 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 7-chloro-6-fluoro-4-oxo-1-(2,2,3,3-tetramethylaziridin-1-yl)quinoline-3-carboxylic acid |
| SMILES | CC1(C)N(n2cc(C(=O)O)c(=O)c3cc(F)c(Cl)cc32)C1(C)C |
| InChI | InChI=1S/C16H16ClFN2O3/c1-15(2)16(3,4)20(15)19-7-9(14(22)23)13(21)8-5-11(18)10(17)6-12(8)19/h5-7H,1-4H3,(H,22,23) |
| InChIKey | SNGUCRGVANZTDI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|