C10H6FNO5 — CID 118596050
6-fluoro-1,7-dihydroxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 118596050) has the molecular formula C10H6FNO5 and a molecular weight of 239.16 g/mol. Its IUPAC name is 6-fluoro-1,7-dihydroxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-1,7-dihydroxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 118596050 |
| Molecular Formula | C10H6FNO5 |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 6-fluoro-1,7-dihydroxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(O)c2cc(O)c(F)cc2c1=O |
| InChI | InChI=1S/C10H6FNO5/c11-6-1-4-7(2-8(6)13)12(17)3-5(9(4)14)10(15)16/h1-3,13,17H,(H,15,16) |
| InChIKey | WJKZZYGURMEVET-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|