C10H6FNO5 — CID 141366573
1-fluoro-6,7-dihydroxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 141366573) has the molecular formula C10H6FNO5 and a molecular weight of 239.16 g/mol. Its IUPAC name is 1-fluoro-6,7-dihydroxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-fluoro-6,7-dihydroxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 141366573 |
| Molecular Formula | C10H6FNO5 |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 1-fluoro-6,7-dihydroxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(F)c2cc(O)c(O)cc2c1=O |
| InChI | InChI=1S/C10H6FNO5/c11-12-3-5(10(16)17)9(15)4-1-7(13)8(14)2-6(4)12/h1-3,13-14H,(H,16,17) |
| InChIKey | FMNSUEFEMHNXCW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|