C16H14N2O7 — CID 132839571
7-(2,6-dioxomorpholin-4-yl)-1-ethyl-6-hydroxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 132839571) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is 7-(2,6-dioxomorpholin-4-yl)-1-ethyl-6-hydroxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(2,6-dioxomorpholin-4-yl)-1-ethyl-6-hydroxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 132839571 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 7-(2,6-dioxomorpholin-4-yl)-1-ethyl-6-hydroxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(O)c(N3CC(=O)OC(=O)C3)cc21 |
| InChI | InChI=1S/C16H14N2O7/c1-2-17-5-9(16(23)24)15(22)8-3-12(19)11(4-10(8)17)18-6-13(20)25-14(21)7-18/h3-5,19H,2,6-7H2,1H3,(H,23,24) |
| InChIKey | WSKMOPGGCYBURN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|