C11H7F2NO3 — CID 10776368
6,7-difluoro-1-methyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 10776368) has the molecular formula C11H7F2NO3 and a molecular weight of 239.18 g/mol. Its IUPAC name is 6,7-difluoro-1-methyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6,7-difluoro-1-methyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10776368 |
| Molecular Formula | C11H7F2NO3 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 6,7-difluoro-1-methyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C11H7F2NO3/c1-14-4-6(11(16)17)10(15)5-2-7(12)8(13)3-9(5)14/h2-4H,1H3,(H,16,17) |
| InChIKey | DHJRWNMTTJCQGO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |