C11H10FNO4S — CID 142937709
7-fluoro-6-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid;methanethiol (PubChem CID 142937709) has the molecular formula C11H10FNO4S and a molecular weight of 271.27 g/mol. Its IUPAC name is 7-fluoro-6-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid;methanethiol.
| Compound Name | 7-fluoro-6-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid;methanethiol |
|---|---|
| PubChem CID | 142937709 |
| Molecular Formula | C11H10FNO4S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 7-fluoro-6-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid;methanethiol |
| SMILES | CS.O=C(O)c1c[nH]c2cc(F)c(O)cc2c1=O |
| InChI | InChI=1S/C10H6FNO4.CH4S/c11-6-2-7-4(1-8(6)13)9(14)5(3-12-7)10(15)16;1-2/h1-3,13H,(H,12,14)(H,15,16);2H,1H3 |
| InChIKey | BOQBUDAKIVPBQU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|