C10H4F2NO3- — CID 7017062
6,7-difluoro-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 7017062) has the molecular formula C10H4F2NO3- and a molecular weight of 224.14 g/mol. Its IUPAC name is 6,7-difluoro-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | 6,7-difluoro-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7017062 |
| Molecular Formula | C10H4F2NO3- |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 6,7-difluoro-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | O=C([O-])c1c[nH]c2cc(F)c(F)cc2c1=O |
| InChI | InChI=1S/C10H5F2NO3/c11-6-1-4-8(2-7(6)12)13-3-5(9(4)14)10(15)16/h1-3H,(H,13,14)(H,15,16)/p-1 |
| InChIKey | URJLZNXCWLEREY-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |