C19H22F3NO3 — CID 142567534
1-octyl-4-oxo-7-(trifluoromethyl)quinoline-3-carboxylic acid (PubChem CID 142567534) has the molecular formula C19H22F3NO3 and a molecular weight of 369.38 g/mol. Its IUPAC name is 1-octyl-4-oxo-7-(trifluoromethyl)quinoline-3-carboxylic acid.
| Compound Name | 1-octyl-4-oxo-7-(trifluoromethyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 142567534 |
| Molecular Formula | C19H22F3NO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-octyl-4-oxo-7-(trifluoromethyl)quinoline-3-carboxylic acid |
| SMILES | CCCCCCCCn1cc(C(=O)O)c(=O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C19H22F3NO3/c1-2-3-4-5-6-7-10-23-12-15(18(25)26)17(24)14-9-8-13(11-16(14)23)19(20,21)22/h8-9,11-12H,2-7,10H2,1H3,(H,25,26) |
| InChIKey | YHBVHMLXFACRGT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|