C29H42FN3O6 — CID 139766010
6-fluoro-1-[2-[2-(1-methoxyethoxy)ethoxy]ethyl]-4-oxo-7-[4-(2-piperidin-4-ylethyl)piperidin-1-yl]quinoline-3-carboxylic acid (PubChem CID 139766010) has the molecular formula C29H42FN3O6 and a molecular weight of 547.67 g/mol. Its IUPAC name is 6-fluoro-1-[2-[2-(1-methoxyethoxy)ethoxy]ethyl]-4-oxo-7-[4-(2-piperidin-4-ylethyl)piperidin-1-yl]quinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-1-[2-[2-(1-methoxyethoxy)ethoxy]ethyl]-4-oxo-7-[4-(2-piperidin-4-ylethyl)piperidin-1-yl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139766010 |
| Molecular Formula | C29H42FN3O6 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | 6-fluoro-1-[2-[2-(1-methoxyethoxy)ethoxy]ethyl]-4-oxo-7-[4-(2-piperidin-4-ylethyl)piperidin-1-yl]quinoline-3-carboxylic acid |
| SMILES | COC(C)OCCOCCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCC(CCC4CCNCC4)CC3)cc21 |
| InChI | InChI=1S/C29H42FN3O6/c1-20(37-2)39-16-15-38-14-13-33-19-24(29(35)36)28(34)23-17-25(30)27(18-26(23)33)32-11-7-22(8-12-32)4-3-21-5-9-31-10-6-21/h17-22,31H,3-16H2,1-2H3,(H,35,36) |
| InChIKey | WRBBEZHMDUNLDG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|