C19H24FN3O4 — CID 70471245
ethyl [1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinolin-3-yl] carbonate (PubChem CID 70471245) has the molecular formula C19H24FN3O4 and a molecular weight of 377.42 g/mol. Its IUPAC name is ethyl [1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinolin-3-yl] carbonate.
| Compound Name | ethyl [1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinolin-3-yl] carbonate |
|---|---|
| PubChem CID | 70471245 |
| Molecular Formula | C19H24FN3O4 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | ethyl [1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinolin-3-yl] carbonate |
| SMILES | CCOC(=O)Oc1cn(CC)c2cc(N3CCN(C)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C19H24FN3O4/c1-4-22-12-17(27-19(25)26-5-2)18(24)13-10-14(20)16(11-15(13)22)23-8-6-21(3)7-9-23/h10-12H,4-9H2,1-3H3 |
| InChIKey | TWHZXMFDJQQOAA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |