C25H26FN3O2 — CID 163450120
1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-3-[(E)-3-oxo-3-phenylprop-1-enyl]quinolin-4-one (PubChem CID 163450120) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-3-[(E)-3-oxo-3-phenylprop-1-enyl]quinolin-4-one.
| Compound Name | 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-3-[(E)-3-oxo-3-phenylprop-1-enyl]quinolin-4-one |
|---|---|
| PubChem CID | 163450120 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-3-[(E)-3-oxo-3-phenylprop-1-enyl]quinolin-4-one |
| SMILES | CCn1cc(/C=C/C(=O)c2ccccc2)c(=O)c2cc(F)c(N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C25H26FN3O2/c1-3-28-17-19(9-10-24(30)18-7-5-4-6-8-18)25(31)20-15-21(26)23(16-22(20)28)29-13-11-27(2)12-14-29/h4-10,15-17H,3,11-14H2,1-2H3/b10-9+ |
| InChIKey | BFWOVNIGGUKPBF-MDZDMXLPSA-N |
| XLogP | 3.81 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|