About [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate
[1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 68564465) has the molecular formula C21H19Cl2NO4
and a molecular weight of 420.29 g/mol. Its IUPAC name is [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate |
| PubChem CID | 68564465 |
| Molecular Formula | C21H19Cl2NO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | CCCCn1cc(OC(=O)O)c(=O)c2cc(Cc3cccc(Cl)c3Cl)ccc21 |
| InChI | InChI=1S/C21H19Cl2NO4/c1-2-3-9-24-12-18(28-21(26)27)20(25)15-11-13(7-8-17(15)24)10-14-5-4-6-16(22)19(14)23/h4-8,11-12H,2-3,9-10H2,1H3,(H,26,27) |
| InChIKey | BRHULGGBAKOHBU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate?
The IUPAC name of [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate (CID 68564465) is [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate.
What is the SMILES notation for [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate?
The canonical SMILES for [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate is CCCCn1cc(OC(=O)O)c(=O)c2cc(Cc3cccc(Cl)c3Cl)ccc21.
What is the InChIKey of [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate?
The InChIKey is BRHULGGBAKOHBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19Cl2NO4/c1-2-3-9-24-12-18(28-21(26)27)20(25)15-11-13(7-8-17(15)24)10-14-5-4-6-16(22)19(14)23/h4-8,11-12H,2-3,9-10H2,1H3,(H,26,27).
What are the key properties of [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate?
[1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate has a molecular weight of 420.29 g/mol, XLogP of 5.76, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-butyl-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate is sourced from PubChem (CID 68564465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).