About [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate
[6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 68563003) has the molecular formula C19H15Cl2NO4S
and a molecular weight of 424.31 g/mol. Its IUPAC name is [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate |
| PubChem CID | 68563003 |
| Molecular Formula | C19H15Cl2NO4S |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | CSCn1cc(OC(=O)O)c(=O)c2cc(Cc3cccc(Cl)c3Cl)ccc21 |
| InChI | InChI=1S/C19H15Cl2NO4S/c1-27-10-22-9-16(26-19(24)25)18(23)13-8-11(5-6-15(13)22)7-12-3-2-4-14(20)17(12)21/h2-6,8-9H,7,10H2,1H3,(H,24,25) |
| InChIKey | XQQWVPHAHDRRDU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate?
The IUPAC name of [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate (CID 68563003) is [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate.
What is the SMILES notation for [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate?
The canonical SMILES for [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate is CSCn1cc(OC(=O)O)c(=O)c2cc(Cc3cccc(Cl)c3Cl)ccc21.
What is the InChIKey of [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate?
The InChIKey is XQQWVPHAHDRRDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2NO4S/c1-27-10-22-9-16(26-19(24)25)18(23)13-8-11(5-6-15(13)22)7-12-3-2-4-14(20)17(12)21/h2-6,8-9H,7,10H2,1H3,(H,24,25).
What are the key properties of [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate?
[6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate has a molecular weight of 424.31 g/mol, XLogP of 5.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(2,3-dichlorophenyl)methyl]-1-(methylsulfanylmethyl)-4-oxoquinolin-3-yl] hydrogen carbonate is sourced from PubChem (CID 68563003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).