About [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate
[7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 68562118) has the molecular formula C17H10ClF2NO4
and a molecular weight of 365.72 g/mol. Its IUPAC name is [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate |
| PubChem CID | 68562118 |
| Molecular Formula | C17H10ClF2NO4 |
| Molecular Weight | 365.72 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cn(Cc2ccc(F)c(F)c2)c2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C17H10ClF2NO4/c18-10-2-3-11-14(6-10)21(8-15(16(11)22)25-17(23)24)7-9-1-4-12(19)13(20)5-9/h1-6,8H,7H2,(H,23,24) |
| InChIKey | SFEYOMFKAHRAPP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.72 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate?
The IUPAC name of [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate (CID 68562118) is [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate.
What is the SMILES notation for [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate?
The canonical SMILES for [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate is O=C(O)Oc1cn(Cc2ccc(F)c(F)c2)c2cc(Cl)ccc2c1=O.
What is the InChIKey of [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate?
The InChIKey is SFEYOMFKAHRAPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClF2NO4/c18-10-2-3-11-14(6-10)21(8-15(16(11)22)25-17(23)24)7-9-1-4-12(19)13(20)5-9/h1-6,8H,7H2,(H,23,24).
What are the key properties of [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate?
[7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate has a molecular weight of 365.72 g/mol, XLogP of 4.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-chloro-1-[(3,4-difluorophenyl)methyl]-4-oxoquinolin-3-yl] hydrogen carbonate is sourced from PubChem (CID 68562118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).