C20H13F2NO5 — CID 24950231
(Z)-4-[7-fluoro-1-[(4-fluorophenyl)methyl]-4-oxoquinolin-3-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 24950231) has the molecular formula C20H13F2NO5 and a molecular weight of 385.32 g/mol. Its IUPAC name is (Z)-4-[7-fluoro-1-[(4-fluorophenyl)methyl]-4-oxoquinolin-3-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[7-fluoro-1-[(4-fluorophenyl)methyl]-4-oxoquinolin-3-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 24950231 |
| Molecular Formula | C20H13F2NO5 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (Z)-4-[7-fluoro-1-[(4-fluorophenyl)methyl]-4-oxoquinolin-3-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1cn(Cc2ccc(F)cc2)c2cc(F)ccc2c1=O |
| InChI | InChI=1S/C20H13F2NO5/c21-12-3-1-11(2-4-12)9-23-10-15(17(24)8-18(25)20(27)28)19(26)14-6-5-13(22)7-16(14)23/h1-8,10,24H,9H2,(H,27,28)/b17-8- |
| InChIKey | YXJJXZCIDDHHRF-IUXPMGMMSA-N |
| XLogP | 2.88 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|