C22H17FN2O6 — CID 58914584
(Z)-4-[1-benzyl-3-[(4-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 58914584) has the molecular formula C22H17FN2O6 and a molecular weight of 424.38 g/mol. Its IUPAC name is (Z)-4-[1-benzyl-3-[(4-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[1-benzyl-3-[(4-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 58914584 |
| Molecular Formula | C22H17FN2O6 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (Z)-4-[1-benzyl-3-[(4-fluorophenyl)methyl]-2,4-dioxopyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1cn(Cc2ccccc2)c(=O)n(Cc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C22H17FN2O6/c23-16-8-6-15(7-9-16)12-25-20(28)17(18(26)10-19(27)21(29)30)13-24(22(25)31)11-14-4-2-1-3-5-14/h1-10,13,26H,11-12H2,(H,29,30)/b18-10- |
| InChIKey | IMVZFGJQNQNBCS-ZDLGFXPLSA-N |
| XLogP | 1.80 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|