C19H15F2NO3 — CID 53418933
ethyl 7-fluoro-1-[(3-fluorophenyl)methyl]-4-oxoquinoline-3-carboxylate (PubChem CID 53418933) has the molecular formula C19H15F2NO3 and a molecular weight of 343.33 g/mol. Its IUPAC name is ethyl 7-fluoro-1-[(3-fluorophenyl)methyl]-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-fluoro-1-[(3-fluorophenyl)methyl]-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 53418933 |
| Molecular Formula | C19H15F2NO3 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | ethyl 7-fluoro-1-[(3-fluorophenyl)methyl]-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2cccc(F)c2)c2cc(F)ccc2c1=O |
| InChI | InChI=1S/C19H15F2NO3/c1-2-25-19(24)16-11-22(10-12-4-3-5-13(20)8-12)17-9-14(21)6-7-15(17)18(16)23/h3-9,11H,2,10H2,1H3 |
| InChIKey | QULSMJAGZOPPQB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |