C21H18FNO6 — CID 51039352
(Z)-4-[1-[(4-fluorophenyl)methyl]-5,7-dimethoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 51039352) has the molecular formula C21H18FNO6 and a molecular weight of 399.37 g/mol. Its IUPAC name is (Z)-4-[1-[(4-fluorophenyl)methyl]-5,7-dimethoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[1-[(4-fluorophenyl)methyl]-5,7-dimethoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 51039352 |
| Molecular Formula | C21H18FNO6 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (Z)-4-[1-[(4-fluorophenyl)methyl]-5,7-dimethoxyindol-3-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | COc1cc(OC)c2c(c1)c(/C(O)=C/C(=O)C(=O)O)cn2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H18FNO6/c1-28-14-7-15-16(17(24)9-18(25)21(26)27)11-23(20(15)19(8-14)29-2)10-12-3-5-13(22)6-4-12/h3-9,11,24H,10H2,1-2H3,(H,26,27)/b17-9- |
| InChIKey | PQJLOYUYYFCGMF-MFOYZWKCSA-N |
| XLogP | 3.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|