C20H14F3NO5 — CID 25193236
(Z)-4-hydroxy-4-[4-methoxy-1-[(2,3,4-trifluorophenyl)methyl]indol-3-yl]-2-oxobut-3-enoic acid (PubChem CID 25193236) has the molecular formula C20H14F3NO5 and a molecular weight of 405.33 g/mol. Its IUPAC name is (Z)-4-hydroxy-4-[4-methoxy-1-[(2,3,4-trifluorophenyl)methyl]indol-3-yl]-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-hydroxy-4-[4-methoxy-1-[(2,3,4-trifluorophenyl)methyl]indol-3-yl]-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 25193236 |
| Molecular Formula | C20H14F3NO5 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (Z)-4-hydroxy-4-[4-methoxy-1-[(2,3,4-trifluorophenyl)methyl]indol-3-yl]-2-oxobut-3-enoic acid |
| SMILES | COc1cccc2c1c(/C(O)=C/C(=O)C(=O)O)cn2Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H14F3NO5/c1-29-16-4-2-3-13-17(16)11(14(25)7-15(26)20(27)28)9-24(13)8-10-5-6-12(21)19(23)18(10)22/h2-7,9,25H,8H2,1H3,(H,27,28)/b14-7- |
| InChIKey | NUFGDLMERZALMI-AUWJEWJLSA-N |
| XLogP | 3.67 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|