C22H17ClFNO5 — CID 122179305
ethyl (Z)-4-[1-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolin-3-yl]-4-hydroxy-2-oxobut-3-enoate (PubChem CID 122179305) has the molecular formula C22H17ClFNO5 and a molecular weight of 429.83 g/mol. Its IUPAC name is ethyl (Z)-4-[1-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolin-3-yl]-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | ethyl (Z)-4-[1-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolin-3-yl]-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 122179305 |
| Molecular Formula | C22H17ClFNO5 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | ethyl (Z)-4-[1-[(3-chloro-2-fluorophenyl)methyl]-4-oxoquinolin-3-yl]-4-hydroxy-2-oxobut-3-enoate |
| SMILES | CCOC(=O)C(=O)/C=C(\O)c1cn(Cc2cccc(Cl)c2F)c2ccccc2c1=O |
| InChI | InChI=1S/C22H17ClFNO5/c1-2-30-22(29)19(27)10-18(26)15-12-25(11-13-6-5-8-16(23)20(13)24)17-9-4-3-7-14(17)21(15)28/h3-10,12,26H,2,11H2,1H3/b18-10- |
| InChIKey | PCWZDDVQCUPHGU-ZDLGFXPLSA-N |
| XLogP | 3.87 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|