C20H17NO5 — CID 75968597
4-hydroxy-4-[4-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]-2-oxobut-3-enoic acid (PubChem CID 75968597) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-hydroxy-4-[4-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]-2-oxobut-3-enoic acid.
| Compound Name | 4-hydroxy-4-[4-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 75968597 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 4-hydroxy-4-[4-hydroxy-1-[(3-methylphenyl)methyl]indol-3-yl]-2-oxobut-3-enoic acid |
| SMILES | Cc1cccc(Cn2cc(C(O)=CC(=O)C(=O)O)c3c(O)cccc32)c1 |
| InChI | InChI=1S/C20H17NO5/c1-12-4-2-5-13(8-12)10-21-11-14(17(23)9-18(24)20(25)26)19-15(21)6-3-7-16(19)22/h2-9,11,22-23H,10H2,1H3,(H,25,26) |
| InChIKey | FRIZKWTWICRLSY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|