C13H12BrNO2 — CID 114604151
4-bromo-1-[(3-methylphenyl)methyl]pyrrole-2-carboxylic acid (PubChem CID 114604151) has the molecular formula C13H12BrNO2 and a molecular weight of 294.15 g/mol. Its IUPAC name is 4-bromo-1-[(3-methylphenyl)methyl]pyrrole-2-carboxylic acid.
| Compound Name | 4-bromo-1-[(3-methylphenyl)methyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114604151 |
| Molecular Formula | C13H12BrNO2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 4-bromo-1-[(3-methylphenyl)methyl]pyrrole-2-carboxylic acid |
| SMILES | Cc1cccc(Cn2cc(Br)cc2C(=O)O)c1 |
| InChI | InChI=1S/C13H12BrNO2/c1-9-3-2-4-10(5-9)7-15-8-11(14)6-12(15)13(16)17/h2-6,8H,7H2,1H3,(H,16,17) |
| InChIKey | GVXNWFHZRMHFFZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |