C19H18N2O2 — CID 22520187
1-benzyl-4-[(3-methylphenyl)methyl]pyrazine-2,3-dione (PubChem CID 22520187) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-benzyl-4-[(3-methylphenyl)methyl]pyrazine-2,3-dione.
| Compound Name | 1-benzyl-4-[(3-methylphenyl)methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 22520187 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-benzyl-4-[(3-methylphenyl)methyl]pyrazine-2,3-dione |
| SMILES | Cc1cccc(Cn2ccn(Cc3ccccc3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C19H18N2O2/c1-15-6-5-9-17(12-15)14-21-11-10-20(18(22)19(21)23)13-16-7-3-2-4-8-16/h2-12H,13-14H2,1H3 |
| InChIKey | XJNVFRRBLQCDBG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|