3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid

C13H12N2O4 — CID 62929606

IUPAC3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid
SMILESCn1ccn(Cc2cccc(C(=O)O)c2)c(=O)c1=O
InChIInChI=1S/C13H12N2O4/c1-14-5-6-15(12(17)11(14)16)8-9-3-2-4-10(7-9)13(18)19/h2-7H,8H2,1H3,(H,18,19)
InChIKeyHJAQPLCBUVSJKE-UHFFFAOYSA-N
MW260.25 g/mol
LogP0.29
Rot. Bonds3

About 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid

3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid (PubChem CID 62929606) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid.

Molecular Properties

Compound Name3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid
PubChem CID62929606
Molecular FormulaC13H12N2O4
Molecular Weight260.25 g/mol
Exact Mass260.08
IUPAC Name3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid
SMILESCn1ccn(Cc2cccc(C(=O)O)c2)c(=O)c1=O
InChIInChI=1S/C13H12N2O4/c1-14-5-6-15(12(17)11(14)16)8-9-3-2-4-10(7-9)13(18)19/h2-7H,8H2,1H3,(H,18,19)
InChIKeyHJAQPLCBUVSJKE-UHFFFAOYSA-N
XLogP0.29
TPSA81.30 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.25
LogP ≤ 50.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid?
The IUPAC name of 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid (CID 62929606) is 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid.
What is the SMILES notation for 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid?
The canonical SMILES for 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid is Cn1ccn(Cc2cccc(C(=O)O)c2)c(=O)c1=O.
What is the InChIKey of 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid?
The InChIKey is HJAQPLCBUVSJKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4/c1-14-5-6-15(12(17)11(14)16)8-9-3-2-4-10(7-9)13(18)19/h2-7H,8H2,1H3,(H,18,19).
What are the key properties of 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid?
3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid has a molecular weight of 260.25 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzoic acid is sourced from PubChem (CID 62929606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).