C14H14N2O4 — CID 105345403
2-[4-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]phenyl]acetic acid (PubChem CID 105345403) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[4-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 105345403 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[4-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]phenyl]acetic acid |
| SMILES | Cn1ccn(Cc2ccc(CC(=O)O)cc2)c(=O)c1=O |
| InChI | InChI=1S/C14H14N2O4/c1-15-6-7-16(14(20)13(15)19)9-11-4-2-10(3-5-11)8-12(17)18/h2-7H,8-9H2,1H3,(H,17,18) |
| InChIKey | AYCYULVSDZERAX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|