C13H12FNO — CID 174323463
3-fluoro-1-[(3-methylphenyl)methyl]pyridin-2-one (PubChem CID 174323463) has the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. Its IUPAC name is 3-fluoro-1-[(3-methylphenyl)methyl]pyridin-2-one.
| Compound Name | 3-fluoro-1-[(3-methylphenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 174323463 |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-fluoro-1-[(3-methylphenyl)methyl]pyridin-2-one |
| SMILES | Cc1cccc(Cn2cccc(F)c2=O)c1 |
| InChI | InChI=1S/C13H12FNO/c1-10-4-2-5-11(8-10)9-15-7-3-6-12(14)13(15)16/h2-8H,9H2,1H3 |
| InChIKey | CTEOWERGXNXBIO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |