C11H16BrNO2 — CID 103463798
4-bromo-1-(2,2-dimethylbutyl)pyrrole-2-carboxylic acid (PubChem CID 103463798) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 4-bromo-1-(2,2-dimethylbutyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-bromo-1-(2,2-dimethylbutyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 103463798 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-bromo-1-(2,2-dimethylbutyl)pyrrole-2-carboxylic acid |
| SMILES | CCC(C)(C)Cn1cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C11H16BrNO2/c1-4-11(2,3)7-13-6-8(12)5-9(13)10(14)15/h5-6H,4,7H2,1-3H3,(H,14,15) |
| InChIKey | QLXMJPRWHDZZER-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |