C10H14BrNO4 — CID 114604802
4-bromo-1-[2-(2-methoxyethoxy)ethyl]pyrrole-2-carboxylic acid (PubChem CID 114604802) has the molecular formula C10H14BrNO4 and a molecular weight of 292.13 g/mol. Its IUPAC name is 4-bromo-1-[2-(2-methoxyethoxy)ethyl]pyrrole-2-carboxylic acid.
| Compound Name | 4-bromo-1-[2-(2-methoxyethoxy)ethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114604802 |
| Molecular Formula | C10H14BrNO4 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 4-bromo-1-[2-(2-methoxyethoxy)ethyl]pyrrole-2-carboxylic acid |
| SMILES | COCCOCCn1cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C10H14BrNO4/c1-15-4-5-16-3-2-12-7-8(11)6-9(12)10(13)14/h6-7H,2-5H2,1H3,(H,13,14) |
| InChIKey | RYAPXTQZNBDJEH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|