C12H18BrNO2 — CID 114606478
4-bromo-1-(2,3,3-trimethylbutyl)pyrrole-2-carboxylic acid (PubChem CID 114606478) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 4-bromo-1-(2,3,3-trimethylbutyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-bromo-1-(2,3,3-trimethylbutyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114606478 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-bromo-1-(2,3,3-trimethylbutyl)pyrrole-2-carboxylic acid |
| SMILES | CC(Cn1cc(Br)cc1C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H18BrNO2/c1-8(12(2,3)4)6-14-7-9(13)5-10(14)11(15)16/h5,7-8H,6H2,1-4H3,(H,15,16) |
| InChIKey | YEODOFDLJCUCON-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |