C22H14ClFN2O2 — CID 52998470
6-chloro-1-[(4-fluorophenyl)methyl]-3-(pyridine-4-carbonyl)quinolin-4-one (PubChem CID 52998470) has the molecular formula C22H14ClFN2O2 and a molecular weight of 392.82 g/mol. Its IUPAC name is 6-chloro-1-[(4-fluorophenyl)methyl]-3-(pyridine-4-carbonyl)quinolin-4-one.
| Compound Name | 6-chloro-1-[(4-fluorophenyl)methyl]-3-(pyridine-4-carbonyl)quinolin-4-one |
|---|---|
| PubChem CID | 52998470 |
| Molecular Formula | C22H14ClFN2O2 |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 6-chloro-1-[(4-fluorophenyl)methyl]-3-(pyridine-4-carbonyl)quinolin-4-one |
| SMILES | O=C(c1ccncc1)c1cn(Cc2ccc(F)cc2)c2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C22H14ClFN2O2/c23-16-3-6-20-18(11-16)22(28)19(21(27)15-7-9-25-10-8-15)13-26(20)12-14-1-4-17(24)5-2-14/h1-11,13H,12H2 |
| InChIKey | PSVYUQJIEGAEDC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |