C24H18ClN3O3 — CID 53000650
N-(4-chlorophenyl)-2-[6-methyl-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]acetamide (PubChem CID 53000650) has the molecular formula C24H18ClN3O3 and a molecular weight of 431.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[6-methyl-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[6-methyl-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 53000650 |
| Molecular Formula | C24H18ClN3O3 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-[6-methyl-4-oxo-3-(pyridine-4-carbonyl)quinolin-1-yl]acetamide |
| SMILES | Cc1ccc2c(c1)c(=O)c(C(=O)c1ccncc1)cn2CC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18ClN3O3/c1-15-2-7-21-19(12-15)24(31)20(23(30)16-8-10-26-11-9-16)13-28(21)14-22(29)27-18-5-3-17(25)4-6-18/h2-13H,14H2,1H3,(H,27,29) |
| InChIKey | BVYFTMLHTCZXMP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |