C21H19Cl2NO4 — CID 25034433
6-[(2,4-dichlorophenyl)methyl]-1-(4-hydroxybutyl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 25034433) has the molecular formula C21H19Cl2NO4 and a molecular weight of 420.29 g/mol. Its IUPAC name is 6-[(2,4-dichlorophenyl)methyl]-1-(4-hydroxybutyl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6-[(2,4-dichlorophenyl)methyl]-1-(4-hydroxybutyl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 25034433 |
| Molecular Formula | C21H19Cl2NO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 6-[(2,4-dichlorophenyl)methyl]-1-(4-hydroxybutyl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(CCCCO)c2ccc(Cc3ccc(Cl)cc3Cl)cc2c1=O |
| InChI | InChI=1S/C21H19Cl2NO4/c22-15-5-4-14(18(23)11-15)9-13-3-6-19-16(10-13)20(26)17(21(27)28)12-24(19)7-1-2-8-25/h3-6,10-12,25H,1-2,7-9H2,(H,27,28) |
| InChIKey | GNKSISMYHDFYGM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|