C20H20N2O6S — CID 23083952
1-(2-hydroxyethyl)-6-[[2-(methylsulfamoyl)phenyl]methyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 23083952) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-6-[[2-(methylsulfamoyl)phenyl]methyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)-6-[[2-(methylsulfamoyl)phenyl]methyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23083952 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-6-[[2-(methylsulfamoyl)phenyl]methyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CNS(=O)(=O)c1ccccc1Cc1ccc2c(c1)c(=O)c(C(=O)O)cn2CCO |
| InChI | InChI=1S/C20H20N2O6S/c1-21-29(27,28)18-5-3-2-4-14(18)10-13-6-7-17-15(11-13)19(24)16(20(25)26)12-22(17)8-9-23/h2-7,11-12,21,23H,8-10H2,1H3,(H,25,26) |
| InChIKey | KYDREXLEGMSXPQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |