C13H13NO4 — CID 82244448
1-(2-hydroxyethyl)-8-methyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 82244448) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-8-methyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)-8-methyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 82244448 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-(2-hydroxyethyl)-8-methyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1cccc2c(=O)c(C(=O)O)cn(CCO)c12 |
| InChI | InChI=1S/C13H13NO4/c1-8-3-2-4-9-11(8)14(5-6-15)7-10(12(9)16)13(17)18/h2-4,7,15H,5-6H2,1H3,(H,17,18) |
| InChIKey | RKAVJCHBJFQXNE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |