C13H8F3NO5 — CID 43831649
1-(carboxymethyl)-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid (PubChem CID 43831649) has the molecular formula C13H8F3NO5 and a molecular weight of 315.20 g/mol. Its IUPAC name is 1-(carboxymethyl)-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid.
| Compound Name | 1-(carboxymethyl)-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 43831649 |
| Molecular Formula | C13H8F3NO5 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-(carboxymethyl)-4-oxo-8-(trifluoromethyl)quinoline-3-carboxylic acid |
| SMILES | O=C(O)Cn1cc(C(=O)O)c(=O)c2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C13H8F3NO5/c14-13(15,16)8-3-1-2-6-10(8)17(5-9(18)19)4-7(11(6)20)12(21)22/h1-4H,5H2,(H,18,19)(H,21,22) |
| InChIKey | JVBGQVZGRYRMIA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |