C19H13F3INO3 — CID 162605099
8-(methylidene-λ3-iodanyl)-4-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxylic acid (PubChem CID 162605099) has the molecular formula C19H13F3INO3 and a molecular weight of 487.22 g/mol. Its IUPAC name is 8-(methylidene-λ3-iodanyl)-4-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxylic acid.
| Compound Name | 8-(methylidene-λ3-iodanyl)-4-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 162605099 |
| Molecular Formula | C19H13F3INO3 |
| Molecular Weight | 487.22 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | 8-(methylidene-λ3-iodanyl)-4-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxylic acid |
| SMILES | C=Ic1cccc2c(=O)c(C(=O)O)cn(Cc3ccc(C(F)(F)F)cc3)c12 |
| InChI | InChI=1S/C19H13F3INO3/c1-23-15-4-2-3-13-16(15)24(10-14(17(13)25)18(26)27)9-11-5-7-12(8-6-11)19(20,21)22/h2-8,10H,1,9H2,(H,26,27) |
| InChIKey | JLBAIPDNUZVCSE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|