C33H37F5N8O3 — CID 52915150
7-[4-[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]piperazin-1-yl]-6,8-difluoro-4-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxylic acid (PubChem CID 52915150) has the molecular formula C33H37F5N8O3 and a molecular weight of 688.70 g/mol. Its IUPAC name is 7-[4-[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]piperazin-1-yl]-6,8-difluoro-4-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxylic acid.
| Compound Name | 7-[4-[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]piperazin-1-yl]-6,8-difluoro-4-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 52915150 |
| Molecular Formula | C33H37F5N8O3 |
| Molecular Weight | 688.70 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | 7-[4-[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]piperazin-1-yl]-6,8-difluoro-4-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]quinoline-3-carboxylic acid |
| SMILES | CC(C)(C)Nc1nc(NC(C)(C)C)nc(N2CCN(c3c(F)cc4c(=O)c(C(=O)O)cn(Cc5ccc(C(F)(F)F)cc5)c4c3F)CC2)n1 |
| InChI | InChI=1S/C33H37F5N8O3/c1-31(2,3)42-28-39-29(43-32(4,5)6)41-30(40-28)45-13-11-44(12-14-45)25-22(34)15-20-24(23(25)35)46(17-21(26(20)47)27(48)49)16-18-7-9-19(10-8-18)33(36,37)38/h7-10,15,17H,11-14,16H2,1-6H3,(H,48,49)(H2,39,40,41,42,43) |
| InChIKey | ZHHMOMIROZTTME-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |