C21H14FN3O3 — CID 46225417
8-fluoro-4-oxo-1-[(4-pyrimidin-5-ylphenyl)methyl]quinoline-3-carboxylic acid (PubChem CID 46225417) has the molecular formula C21H14FN3O3 and a molecular weight of 375.36 g/mol. Its IUPAC name is 8-fluoro-4-oxo-1-[(4-pyrimidin-5-ylphenyl)methyl]quinoline-3-carboxylic acid.
| Compound Name | 8-fluoro-4-oxo-1-[(4-pyrimidin-5-ylphenyl)methyl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 46225417 |
| Molecular Formula | C21H14FN3O3 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 8-fluoro-4-oxo-1-[(4-pyrimidin-5-ylphenyl)methyl]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccc(-c3cncnc3)cc2)c2c(F)cccc2c1=O |
| InChI | InChI=1S/C21H14FN3O3/c22-18-3-1-2-16-19(18)25(11-17(20(16)26)21(27)28)10-13-4-6-14(7-5-13)15-8-23-12-24-9-15/h1-9,11-12H,10H2,(H,27,28) |
| InChIKey | WBBLUZBWJXMSTO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |