C22H22FN3O4 — CID 167361045
ethyl 5-acetamido-7-anilino-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 167361045) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is ethyl 5-acetamido-7-anilino-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 5-acetamido-7-anilino-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 167361045 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | ethyl 5-acetamido-7-anilino-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)c2cc(Nc3ccccc3)c(F)c(NC(C)=O)c2c1=O |
| InChI | InChI=1S/C22H22FN3O4/c1-4-26-12-15(22(29)30-5-2)21(28)18-17(26)11-16(19(23)20(18)24-13(3)27)25-14-9-7-6-8-10-14/h6-12,25H,4-5H2,1-3H3,(H,24,27) |
| InChIKey | WDKBRJHMRHWXPG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |