C16H13Cl2NO3 — CID 163353217
ethyl 1-but-2-ynyl-5,7-dichloro-4-oxoquinoline-3-carboxylate (PubChem CID 163353217) has the molecular formula C16H13Cl2NO3 and a molecular weight of 338.19 g/mol. Its IUPAC name is ethyl 1-but-2-ynyl-5,7-dichloro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-but-2-ynyl-5,7-dichloro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 163353217 |
| Molecular Formula | C16H13Cl2NO3 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | ethyl 1-but-2-ynyl-5,7-dichloro-4-oxoquinoline-3-carboxylate |
| SMILES | CC#CCn1cc(C(=O)OCC)c(=O)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C16H13Cl2NO3/c1-3-5-6-19-9-11(16(21)22-4-2)15(20)14-12(18)7-10(17)8-13(14)19/h7-9H,4,6H2,1-2H3 |
| InChIKey | HQIWILSTPBTYHU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|