C22H22FN3O3 — CID 167361022
5-amino-1-ethyl-6-fluoro-4-oxo-7-[(2-phenylcyclobutyl)amino]quinoline-3-carboxylic acid (PubChem CID 167361022) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 5-amino-1-ethyl-6-fluoro-4-oxo-7-[(2-phenylcyclobutyl)amino]quinoline-3-carboxylic acid.
| Compound Name | 5-amino-1-ethyl-6-fluoro-4-oxo-7-[(2-phenylcyclobutyl)amino]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 167361022 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 5-amino-1-ethyl-6-fluoro-4-oxo-7-[(2-phenylcyclobutyl)amino]quinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2c(N)c(F)c(NC3CCC3c3ccccc3)cc21 |
| InChI | InChI=1S/C22H22FN3O3/c1-2-26-11-14(22(28)29)21(27)18-17(26)10-16(19(23)20(18)24)25-15-9-8-13(15)12-6-4-3-5-7-12/h3-7,10-11,13,15,25H,2,8-9,24H2,1H3,(H,28,29) |
| InChIKey | LAGSWUMVDMTGFD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|