5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid

C14H14ClNO3 — CID 90379692

IUPAC5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid
SMILESCCn1cc(C(=O)O)c(=O)c2c(Cl)c(C)c(C)cc21
InChIInChI=1S/C14H14ClNO3/c1-4-16-6-9(14(18)19)13(17)11-10(16)5-7(2)8(3)12(11)15/h5-6H,4H2,1-3H3,(H,18,19)
InChIKeyKUYYGECQEWAMLU-UHFFFAOYSA-N
MW279.72 g/mol
LogP2.99
Rot. Bonds2

About 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid

5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 90379692) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid.

Molecular Properties

Compound Name5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid
PubChem CID90379692
Molecular FormulaC14H14ClNO3
Molecular Weight279.72 g/mol
Exact Mass279.07
IUPAC Name5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid
SMILESCCn1cc(C(=O)O)c(=O)c2c(Cl)c(C)c(C)cc21
InChIInChI=1S/C14H14ClNO3/c1-4-16-6-9(14(18)19)13(17)11-10(16)5-7(2)8(3)12(11)15/h5-6H,4H2,1-3H3,(H,18,19)
InChIKeyKUYYGECQEWAMLU-UHFFFAOYSA-N
XLogP2.99
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.72
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid?
The IUPAC name of 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid (CID 90379692) is 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid.
What is the SMILES notation for 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid?
The canonical SMILES for 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid is CCn1cc(C(=O)O)c(=O)c2c(Cl)c(C)c(C)cc21.
What is the InChIKey of 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid?
The InChIKey is KUYYGECQEWAMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO3/c1-4-16-6-9(14(18)19)13(17)11-10(16)5-7(2)8(3)12(11)15/h5-6H,4H2,1-3H3,(H,18,19).
What are the key properties of 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid?
5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid has a molecular weight of 279.72 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid is sourced from PubChem (CID 90379692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).