C14H14ClNO3 — CID 90379692
5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 90379692) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 90379692 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 5-chloro-1-ethyl-6,7-dimethyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2c(Cl)c(C)c(C)cc21 |
| InChI | InChI=1S/C14H14ClNO3/c1-4-16-6-9(14(18)19)13(17)11-10(16)5-7(2)8(3)12(11)15/h5-6H,4H2,1-3H3,(H,18,19) |
| InChIKey | KUYYGECQEWAMLU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |