C21H19FN4O — CID 167361012
5-amino-1-ethyl-6-fluoro-4-oxo-7-[[(1R,2S)-2-phenylcyclopropyl]amino]quinoline-3-carbonitrile (PubChem CID 167361012) has the molecular formula C21H19FN4O and a molecular weight of 362.41 g/mol. Its IUPAC name is 5-amino-1-ethyl-6-fluoro-4-oxo-7-[[(1R,2S)-2-phenylcyclopropyl]amino]quinoline-3-carbonitrile.
| Compound Name | 5-amino-1-ethyl-6-fluoro-4-oxo-7-[[(1R,2S)-2-phenylcyclopropyl]amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 167361012 |
| Molecular Formula | C21H19FN4O |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 5-amino-1-ethyl-6-fluoro-4-oxo-7-[[(1R,2S)-2-phenylcyclopropyl]amino]quinoline-3-carbonitrile |
| SMILES | CCn1cc(C#N)c(=O)c2c(N)c(F)c(N[C@@H]3C[C@H]3c3ccccc3)cc21 |
| InChI | InChI=1S/C21H19FN4O/c1-2-26-11-13(10-23)21(27)18-17(26)9-16(19(22)20(18)24)25-15-8-14(15)12-6-4-3-5-7-12/h3-7,9,11,14-15,25H,2,8,24H2,1H3/t14-,15+/m0/s1 |
| InChIKey | KGKUSBOSOJNWCJ-LSDHHAIUSA-N |
| XLogP | 3.58 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|