C21H19F2N3O3 — CID 167361092
5-amino-1-ethyl-6,8-difluoro-4-oxo-7-[[(1R,2S)-2-phenylcyclopropyl]amino]quinoline-3-carboxylic acid (PubChem CID 167361092) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is 5-amino-1-ethyl-6,8-difluoro-4-oxo-7-[[(1R,2S)-2-phenylcyclopropyl]amino]quinoline-3-carboxylic acid.
| Compound Name | 5-amino-1-ethyl-6,8-difluoro-4-oxo-7-[[(1R,2S)-2-phenylcyclopropyl]amino]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 167361092 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 5-amino-1-ethyl-6,8-difluoro-4-oxo-7-[[(1R,2S)-2-phenylcyclopropyl]amino]quinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2c(N)c(F)c(N[C@@H]3C[C@H]3c3ccccc3)c(F)c21 |
| InChI | InChI=1S/C21H19F2N3O3/c1-2-26-9-12(21(28)29)20(27)14-17(24)15(22)18(16(23)19(14)26)25-13-8-11(13)10-6-4-3-5-7-10/h3-7,9,11,13,25H,2,8,24H2,1H3,(H,28,29)/t11-,13+/m0/s1 |
| InChIKey | RYPZZWGQUKHDLG-WCQYABFASA-N |
| XLogP | 3.55 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|