C18H20F2N2O4 — CID 68821279
cyclopropyl 5-amino-1-ethyl-6,7-difluoro-4-oxo-8-propan-2-yloxyquinoline-3-carboxylate (PubChem CID 68821279) has the molecular formula C18H20F2N2O4 and a molecular weight of 366.36 g/mol. Its IUPAC name is cyclopropyl 5-amino-1-ethyl-6,7-difluoro-4-oxo-8-propan-2-yloxyquinoline-3-carboxylate.
| Compound Name | cyclopropyl 5-amino-1-ethyl-6,7-difluoro-4-oxo-8-propan-2-yloxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 68821279 |
| Molecular Formula | C18H20F2N2O4 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | cyclopropyl 5-amino-1-ethyl-6,7-difluoro-4-oxo-8-propan-2-yloxyquinoline-3-carboxylate |
| SMILES | CCn1cc(C(=O)OC2CC2)c(=O)c2c(N)c(F)c(F)c(OC(C)C)c21 |
| InChI | InChI=1S/C18H20F2N2O4/c1-4-22-7-10(18(24)26-9-5-6-9)16(23)11-14(21)12(19)13(20)17(15(11)22)25-8(2)3/h7-9H,4-6,21H2,1-3H3 |
| InChIKey | PYOSXEYKMFVEIL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|