C15H10F5NO3 — CID 67771319
ethyl 5,6,7,8-tetrafluoro-1-[(1R,2R)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate (PubChem CID 67771319) has the molecular formula C15H10F5NO3 and a molecular weight of 347.24 g/mol. Its IUPAC name is ethyl 5,6,7,8-tetrafluoro-1-[(1R,2R)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 5,6,7,8-tetrafluoro-1-[(1R,2R)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 67771319 |
| Molecular Formula | C15H10F5NO3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | ethyl 5,6,7,8-tetrafluoro-1-[(1R,2R)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn([C@@H]2C[C@H]2F)c2c(F)c(F)c(F)c(F)c2c1=O |
| InChI | InChI=1S/C15H10F5NO3/c1-2-24-15(23)5-4-21(7-3-6(7)16)13-8(14(5)22)9(17)10(18)11(19)12(13)20/h4,6-7H,2-3H2,1H3/t6-,7-/m1/s1 |
| InChIKey | LAEMJDGOUPEDRU-RNFRBKRXSA-N |
| XLogP | 3.02 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|