C16H15F2NO4 — CID 77257437
ethyl 7-fluoro-1-(2-fluorocyclopropyl)-5-hydroxy-8-methyl-4-oxoquinoline-3-carboxylate (PubChem CID 77257437) has the molecular formula C16H15F2NO4 and a molecular weight of 323.30 g/mol. Its IUPAC name is ethyl 7-fluoro-1-(2-fluorocyclopropyl)-5-hydroxy-8-methyl-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-fluoro-1-(2-fluorocyclopropyl)-5-hydroxy-8-methyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 77257437 |
| Molecular Formula | C16H15F2NO4 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | ethyl 7-fluoro-1-(2-fluorocyclopropyl)-5-hydroxy-8-methyl-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2F)c2c(C)c(F)cc(O)c2c1=O |
| InChI | InChI=1S/C16H15F2NO4/c1-3-23-16(22)8-6-19(11-4-10(11)18)14-7(2)9(17)5-12(20)13(14)15(8)21/h5-6,10-11,20H,3-4H2,1-2H3 |
| InChIKey | LTJIVGAFBCOJHD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |