C28H19F6N3O6 — CID 160588884
ethyl 8-cyano-6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate;ethyl 3-(3-cyano-2,4,5-trifluorophenyl)-3-oxopropanoate (PubChem CID 160588884) has the molecular formula C28H19F6N3O6 and a molecular weight of 607.46 g/mol. Its IUPAC name is ethyl 8-cyano-6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate;ethyl 3-(3-cyano-2,4,5-trifluorophenyl)-3-oxopropanoate.
| Compound Name | ethyl 8-cyano-6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate;ethyl 3-(3-cyano-2,4,5-trifluorophenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 160588884 |
| Molecular Formula | C28H19F6N3O6 |
| Molecular Weight | 607.46 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | ethyl 8-cyano-6,7-difluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylate;ethyl 3-(3-cyano-2,4,5-trifluorophenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(F)c(C#N)c1F.CCOC(=O)c1cn([C@@H]2C[C@@H]2F)c2c(C#N)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C16H11F3N2O3.C12H8F3NO3/c1-2-24-16(23)9-6-21(12-4-10(12)17)14-7(15(9)22)3-11(18)13(19)8(14)5-20;1-2-19-10(18)4-9(17)6-3-8(13)12(15)7(5-16)11(6)14/h3,6,10,12H,2,4H2,1H3;3H,2,4H2,1H3/t10-,12+;/m0./s1 |
| InChIKey | RCTCJPIXVUSXTC-XOZOLZJESA-N |
| XLogP | 4.72 |
| TPSA | 139.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|