C15H10ClFN2O3 — CID 18351232
methyl 7-chloro-8-cyano-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 18351232) has the molecular formula C15H10ClFN2O3 and a molecular weight of 320.71 g/mol. Its IUPAC name is methyl 7-chloro-8-cyano-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | methyl 7-chloro-8-cyano-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18351232 |
| Molecular Formula | C15H10ClFN2O3 |
| Molecular Weight | 320.71 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | methyl 7-chloro-8-cyano-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | COC(=O)c1cn(C2CC2)c2c(C#N)c(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C15H10ClFN2O3/c1-22-15(21)10-6-19(7-2-3-7)13-8(14(10)20)4-11(17)12(16)9(13)5-18/h4,6-7H,2-3H2,1H3 |
| InChIKey | RHYJZBMQOHMWHL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.71 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |