C16H15F2N3O6 — CID 67271602
ethyl 6-amino-7-fluoro-1-[(1R,2R)-2-fluorocyclopropyl]-8-methoxy-5-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 67271602) has the molecular formula C16H15F2N3O6 and a molecular weight of 383.31 g/mol. Its IUPAC name is ethyl 6-amino-7-fluoro-1-[(1R,2R)-2-fluorocyclopropyl]-8-methoxy-5-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 6-amino-7-fluoro-1-[(1R,2R)-2-fluorocyclopropyl]-8-methoxy-5-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 67271602 |
| Molecular Formula | C16H15F2N3O6 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | ethyl 6-amino-7-fluoro-1-[(1R,2R)-2-fluorocyclopropyl]-8-methoxy-5-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn([C@@H]2C[C@H]2F)c2c(OC)c(F)c(N)c([N+](=O)[O-])c2c1=O |
| InChI | InChI=1S/C16H15F2N3O6/c1-3-27-16(23)6-5-20(8-4-7(8)17)13-9(14(6)22)12(21(24)25)11(19)10(18)15(13)26-2/h5,7-8H,3-4,19H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | JRKQOUQKCIKTTI-HTQZYQBOSA-N |
| XLogP | 2.10 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|